C18H25N3O9 — CID 98688240
[(2R,3S,4S,5S)-3,4-diacetyloxy-5-(4-butyl-3,5-dioxo-1,2,4-triazin-2-yl)oxolan-2-yl]methyl acetate (PubChem CID 98688240) has the molecular formula C18H25N3O9 and a molecular weight of 427.41 g/mol. Its IUPAC name is [(2R,3S,4S,5S)-3,4-diacetyloxy-5-(4-butyl-3,5-dioxo-1,2,4-triazin-2-yl)oxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4S,5S)-3,4-diacetyloxy-5-(4-butyl-3,5-dioxo-1,2,4-triazin-2-yl)oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 98688240 |
| Molecular Formula | C18H25N3O9 |
| Molecular Weight | 427.41 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | [(2R,3S,4S,5S)-3,4-diacetyloxy-5-(4-butyl-3,5-dioxo-1,2,4-triazin-2-yl)oxolan-2-yl]methyl acetate |
| SMILES | CCCCn1c(=O)cnn([C@H]2O[C@H](COC(C)=O)[C@H](OC(C)=O)[C@@H]2OC(C)=O)c1=O |
| InChI | InChI=1S/C18H25N3O9/c1-5-6-7-20-14(25)8-19-21(18(20)26)17-16(29-12(4)24)15(28-11(3)23)13(30-17)9-27-10(2)22/h8,13,15-17H,5-7,9H2,1-4H3/t13-,15+,16+,17+/m1/s1 |
| InChIKey | QLBKGAOOIWBWNX-IWCQGFGOSA-N |
| XLogP | -0.47 |
| TPSA | 145.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.41 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|