C15H19FN2O10 — CID 15216961
[(2R,3R,4R,5R)-3,4-diacetyloxy-5-(5-fluoro-6-hydroxy-2,4-dioxo-1,3-diazinan-1-yl)oxolan-2-yl]methyl acetate (PubChem CID 15216961) has the molecular formula C15H19FN2O10 and a molecular weight of 406.32 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-3,4-diacetyloxy-5-(5-fluoro-6-hydroxy-2,4-dioxo-1,3-diazinan-1-yl)oxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5R)-3,4-diacetyloxy-5-(5-fluoro-6-hydroxy-2,4-dioxo-1,3-diazinan-1-yl)oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 15216961 |
| Molecular Formula | C15H19FN2O10 |
| Molecular Weight | 406.32 g/mol |
| Exact Mass | 406.10 |
| IUPAC Name | [(2R,3R,4R,5R)-3,4-diacetyloxy-5-(5-fluoro-6-hydroxy-2,4-dioxo-1,3-diazinan-1-yl)oxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](N2C(=O)NC(=O)C(F)C2O)[C@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C15H19FN2O10/c1-5(19)25-4-8-10(26-6(2)20)11(27-7(3)21)14(28-8)18-13(23)9(16)12(22)17-15(18)24/h8-11,13-14,23H,4H2,1-3H3,(H,17,22,24)/t8-,9?,10-,11-,13?,14-/m1/s1 |
| InChIKey | HKEIDOMMZBDNNO-SZBSRSIBSA-N |
| XLogP | -1.65 |
| TPSA | 157.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.32 |
| LogP ≤ 5 | -1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|