C17H22FN7O6 — CID 54278308
[(2R,3R,4R,5R)-3-acetyloxy-5-[4-(2-azidoacetyl)-5-(dimethylaminomethylideneamino)imidazol-1-yl]-4-fluorooxolan-2-yl]methyl acetate (PubChem CID 54278308) has the molecular formula C17H22FN7O6 and a molecular weight of 439.40 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-3-acetyloxy-5-[4-(2-azidoacetyl)-5-(dimethylaminomethylideneamino)imidazol-1-yl]-4-fluorooxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5R)-3-acetyloxy-5-[4-(2-azidoacetyl)-5-(dimethylaminomethylideneamino)imidazol-1-yl]-4-fluorooxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 54278308 |
| Molecular Formula | C17H22FN7O6 |
| Molecular Weight | 439.40 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | [(2R,3R,4R,5R)-3-acetyloxy-5-[4-(2-azidoacetyl)-5-(dimethylaminomethylideneamino)imidazol-1-yl]-4-fluorooxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](n2cnc(C(=O)CN=[N+]=[N-])c2N=CN(C)C)[C@H](F)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C17H22FN7O6/c1-9(26)29-6-12-15(30-10(2)27)13(18)17(31-12)25-8-20-14(11(28)5-22-23-19)16(25)21-7-24(3)4/h7-8,12-13,15,17H,5-6H2,1-4H3/t12-,13-,15-,17-/m1/s1 |
| InChIKey | ROZJDQIQOMEAPP-GKLJAUDBSA-N |
| XLogP | 1.33 |
| TPSA | 161.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.40 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|