C17H19N3O8 — CID 14803152
[(2R,3R,4R,5R)-3,4-diacetyloxy-5-(4-carbamoyl-5-ethynylimidazol-1-yl)oxolan-2-yl]methyl acetate (PubChem CID 14803152) has the molecular formula C17H19N3O8 and a molecular weight of 393.35 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-3,4-diacetyloxy-5-(4-carbamoyl-5-ethynylimidazol-1-yl)oxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5R)-3,4-diacetyloxy-5-(4-carbamoyl-5-ethynylimidazol-1-yl)oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 14803152 |
| Molecular Formula | C17H19N3O8 |
| Molecular Weight | 393.35 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | [(2R,3R,4R,5R)-3,4-diacetyloxy-5-(4-carbamoyl-5-ethynylimidazol-1-yl)oxolan-2-yl]methyl acetate |
| SMILES | C#Cc1c(C(N)=O)ncn1[C@@H]1O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C17H19N3O8/c1-5-11-13(16(18)24)19-7-20(11)17-15(27-10(4)23)14(26-9(3)22)12(28-17)6-25-8(2)21/h1,7,12,14-15,17H,6H2,2-4H3,(H2,18,24)/t12-,14-,15-,17-/m1/s1 |
| InChIKey | IYUCIWAAWOPBLG-DNNBLBMLSA-N |
| XLogP | -0.71 |
| TPSA | 149.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.35 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|