C16H17ClN4O7 — CID 87409908
[(2R,3S,4R,5R)-3,4-diacetyloxy-5-(6-chloropurin-1-yl)oxolan-2-yl]methyl acetate (PubChem CID 87409908) has the molecular formula C16H17ClN4O7 and a molecular weight of 412.79 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-3,4-diacetyloxy-5-(6-chloropurin-1-yl)oxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5R)-3,4-diacetyloxy-5-(6-chloropurin-1-yl)oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 87409908 |
| Molecular Formula | C16H17ClN4O7 |
| Molecular Weight | 412.79 g/mol |
| Exact Mass | 412.08 |
| IUPAC Name | [(2R,3S,4R,5R)-3,4-diacetyloxy-5-(6-chloropurin-1-yl)oxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](n2cnc3ncnc-3c2Cl)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C16H17ClN4O7/c1-7(22)25-4-10-12(26-8(2)23)13(27-9(3)24)16(28-10)21-6-20-15-11(14(21)17)18-5-19-15/h5-6,10,12-13,16H,4H2,1-3H3/t10-,12+,13-,16-/m1/s1 |
| InChIKey | QREZRHNYMWGRPE-QZDOHJIMSA-N |
| XLogP | 0.76 |
| TPSA | 131.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.79 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|