C29H55N3O5Si3 — CID 15280197
1-[(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-5-ethynylimidazole-4-carboxamide (PubChem CID 15280197) has the molecular formula C29H55N3O5Si3 and a molecular weight of 610.03 g/mol. Its IUPAC name is 1-[(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-5-ethynylimidazole-4-carboxamide.
| Compound Name | 1-[(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-5-ethynylimidazole-4-carboxamide |
|---|---|
| PubChem CID | 15280197 |
| Molecular Formula | C29H55N3O5Si3 |
| Molecular Weight | 610.03 g/mol |
| Exact Mass | 609.34 |
| IUPAC Name | 1-[(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-5-ethynylimidazole-4-carboxamide |
| SMILES | C#Cc1c(C(N)=O)ncn1[C@@H]1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C29H55N3O5Si3/c1-17-20-22(25(30)33)31-19-32(20)26-24(37-40(15,16)29(8,9)10)23(36-39(13,14)28(5,6)7)21(35-26)18-34-38(11,12)27(2,3)4/h1,19,21,23-24,26H,18H2,2-16H3,(H2,30,33)/t21-,23-,24-,26-/m1/s1 |
| InChIKey | KSATVRBPBWDTNK-IGGXFAESSA-N |
| XLogP | 6.66 |
| TPSA | 97.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.03 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|