C27H53N5O4SSi3 — CID 101029607
7-[(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-1H-imidazo[4,5-d]triazine-4-thione (PubChem CID 101029607) has the molecular formula C27H53N5O4SSi3 and a molecular weight of 628.08 g/mol. Its IUPAC name is 7-[(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-1H-imidazo[4,5-d]triazine-4-thione.
| Compound Name | 7-[(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-1H-imidazo[4,5-d]triazine-4-thione |
|---|---|
| PubChem CID | 101029607 |
| Molecular Formula | C27H53N5O4SSi3 |
| Molecular Weight | 628.08 g/mol |
| Exact Mass | 627.31 |
| IUPAC Name | 7-[(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-1H-imidazo[4,5-d]triazine-4-thione |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](n2cnc3c(=S)nn[nH]c32)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H53N5O4SSi3/c1-25(2,3)38(10,11)33-16-18-20(35-39(12,13)26(4,5)6)21(36-40(14,15)27(7,8)9)24(34-18)32-17-28-19-22(32)29-31-30-23(19)37/h17-18,20-21,24H,16H2,1-15H3,(H,29,30,37)/t18-,20-,21-,24-/m1/s1 |
| InChIKey | RBYQUXFNFAXPSP-UMCMBGNQSA-N |
| XLogP | 7.58 |
| TPSA | 96.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.08 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|