C17H22ClFN4O6 — CID 173346476
[(2R,3R,4R,5S)-3-acetyloxy-5-[5-(2-chloroacetyl)-4-(dimethylaminomethylideneamino)-1H-imidazol-2-yl]-4-fluorooxolan-2-yl]methyl acetate (PubChem CID 173346476) has the molecular formula C17H22ClFN4O6 and a molecular weight of 432.84 g/mol. Its IUPAC name is [(2R,3R,4R,5S)-3-acetyloxy-5-[5-(2-chloroacetyl)-4-(dimethylaminomethylideneamino)-1H-imidazol-2-yl]-4-fluorooxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5S)-3-acetyloxy-5-[5-(2-chloroacetyl)-4-(dimethylaminomethylideneamino)-1H-imidazol-2-yl]-4-fluorooxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 173346476 |
| Molecular Formula | C17H22ClFN4O6 |
| Molecular Weight | 432.84 g/mol |
| Exact Mass | 432.12 |
| IUPAC Name | [(2R,3R,4R,5S)-3-acetyloxy-5-[5-(2-chloroacetyl)-4-(dimethylaminomethylideneamino)-1H-imidazol-2-yl]-4-fluorooxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](c2nc(N=CN(C)C)c(C(=O)CCl)[nH]2)[C@@H](F)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C17H22ClFN4O6/c1-8(24)27-6-11-14(28-9(2)25)12(19)15(29-11)17-21-13(10(26)5-18)16(22-17)20-7-23(3)4/h7,11-12,14-15H,5-6H2,1-4H3,(H,21,22)/t11-,12+,14-,15-/m1/s1 |
| InChIKey | YGJPIUHHRAIXCP-AYRXBEOTSA-N |
| XLogP | 1.33 |
| TPSA | 123.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.84 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|