C16H18N8O7 — CID 22869886
[(2R,3R,4S)-3,4-diacetyloxy-5-(2-amino-6-azido-7H-purin-8-yl)oxolan-2-yl]methyl acetate (PubChem CID 22869886) has the molecular formula C16H18N8O7 and a molecular weight of 434.37 g/mol. Its IUPAC name is [(2R,3R,4S)-3,4-diacetyloxy-5-(2-amino-6-azido-7H-purin-8-yl)oxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S)-3,4-diacetyloxy-5-(2-amino-6-azido-7H-purin-8-yl)oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 22869886 |
| Molecular Formula | C16H18N8O7 |
| Molecular Weight | 434.37 g/mol |
| Exact Mass | 434.13 |
| IUPAC Name | [(2R,3R,4S)-3,4-diacetyloxy-5-(2-amino-6-azido-7H-purin-8-yl)oxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1OC(c2nc3nc(N)nc(N=[N+]=[N-])c3[nH]2)[C@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C16H18N8O7/c1-5(25)28-4-8-10(29-6(2)26)11(30-7(3)27)12(31-8)15-19-9-13(20-15)21-16(17)22-14(9)23-24-18/h8,10-12H,4H2,1-3H3,(H3,17,19,20,21,22)/t8-,10-,11-,12?/m1/s1 |
| InChIKey | UFFYXZFNFWYECL-SSCYJYLSSA-N |
| XLogP | 0.74 |
| TPSA | 217.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.37 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|