C20H24N6O9 — CID 22869883
[(2R,3R,4S)-3,4-diacetyloxy-5-(2,6-diacetamido-7H-purin-8-yl)oxolan-2-yl]methyl acetate (PubChem CID 22869883) has the molecular formula C20H24N6O9 and a molecular weight of 492.45 g/mol. Its IUPAC name is [(2R,3R,4S)-3,4-diacetyloxy-5-(2,6-diacetamido-7H-purin-8-yl)oxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S)-3,4-diacetyloxy-5-(2,6-diacetamido-7H-purin-8-yl)oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 22869883 |
| Molecular Formula | C20H24N6O9 |
| Molecular Weight | 492.45 g/mol |
| Exact Mass | 492.16 |
| IUPAC Name | [(2R,3R,4S)-3,4-diacetyloxy-5-(2,6-diacetamido-7H-purin-8-yl)oxolan-2-yl]methyl acetate |
| SMILES | CC(=O)Nc1nc(NC(C)=O)c2[nH]c(C3O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H]3OC(C)=O)nc2n1 |
| InChI | InChI=1S/C20H24N6O9/c1-7(27)21-17-13-18(26-20(25-17)22-8(2)28)24-19(23-13)16-15(34-11(5)31)14(33-10(4)30)12(35-16)6-32-9(3)29/h12,14-16H,6H2,1-5H3,(H3,21,22,23,24,25,26,27,28)/t12-,14-,15-,16?/m1/s1 |
| InChIKey | UGEXEDMSRJXGHO-KCMBKRDQSA-N |
| XLogP | 0.14 |
| TPSA | 200.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.45 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|