C15H18N2O8Se — CID 88733488
[(2R,3R,4R)-3,4-diacetyloxy-5-(4-carbamoyl-1,3-selenazol-2-yl)oxolan-2-yl]methyl acetate (PubChem CID 88733488) has the molecular formula C15H18N2O8Se and a molecular weight of 433.28 g/mol. Its IUPAC name is [(2R,3R,4R)-3,4-diacetyloxy-5-(4-carbamoyl-1,3-selenazol-2-yl)oxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R)-3,4-diacetyloxy-5-(4-carbamoyl-1,3-selenazol-2-yl)oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 88733488 |
| Molecular Formula | C15H18N2O8Se |
| Molecular Weight | 433.28 g/mol |
| Exact Mass | 434.02 |
| IUPAC Name | [(2R,3R,4R)-3,4-diacetyloxy-5-(4-carbamoyl-1,3-selenazol-2-yl)oxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1OC(c2nc(C(N)=O)c[se]2)[C@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C15H18N2O8Se/c1-6(18)22-4-10-11(23-7(2)19)12(24-8(3)20)13(25-10)15-17-9(5-26-15)14(16)21/h5,10-13H,4H2,1-3H3,(H2,16,21)/t10-,11-,12-,13?/m1/s1 |
| InChIKey | GXFIQGYGJJDUOA-PFGBXZAXSA-N |
| XLogP | -0.90 |
| TPSA | 144.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.28 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|