C16H18FN5O7 — CID 22869876
[(2R,3R,4S)-3,4-diacetyloxy-5-[(2-fluoro-7H-purin-6-yl)amino]oxolan-2-yl]methyl acetate (PubChem CID 22869876) has the molecular formula C16H18FN5O7 and a molecular weight of 411.35 g/mol. Its IUPAC name is [(2R,3R,4S)-3,4-diacetyloxy-5-[(2-fluoro-7H-purin-6-yl)amino]oxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S)-3,4-diacetyloxy-5-[(2-fluoro-7H-purin-6-yl)amino]oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 22869876 |
| Molecular Formula | C16H18FN5O7 |
| Molecular Weight | 411.35 g/mol |
| Exact Mass | 411.12 |
| IUPAC Name | [(2R,3R,4S)-3,4-diacetyloxy-5-[(2-fluoro-7H-purin-6-yl)amino]oxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1OC(Nc2nc(F)nc3nc[nH]c23)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C16H18FN5O7/c1-6(23)26-4-9-11(27-7(2)24)12(28-8(3)25)15(29-9)20-14-10-13(19-5-18-10)21-16(17)22-14/h5,9,11-12,15H,4H2,1-3H3,(H2,18,19,20,21,22)/t9-,11-,12+,15?/m1/s1 |
| InChIKey | NTYCNKQYLPWYHU-JURLDLKRSA-N |
| XLogP | 0.06 |
| TPSA | 154.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.35 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|