C28H28N2O10S — CID 118265059
[(3R,5R,6S)-3,4,5-triacetyloxy-6-[[5-(naphthalene-2-carbonyl)-1,3-thiazol-2-yl]amino]oxan-2-yl]methyl acetate (PubChem CID 118265059) has the molecular formula C28H28N2O10S and a molecular weight of 584.60 g/mol. Its IUPAC name is [(3R,5R,6S)-3,4,5-triacetyloxy-6-[[5-(naphthalene-2-carbonyl)-1,3-thiazol-2-yl]amino]oxan-2-yl]methyl acetate.
| Compound Name | [(3R,5R,6S)-3,4,5-triacetyloxy-6-[[5-(naphthalene-2-carbonyl)-1,3-thiazol-2-yl]amino]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 118265059 |
| Molecular Formula | C28H28N2O10S |
| Molecular Weight | 584.60 g/mol |
| Exact Mass | 584.15 |
| IUPAC Name | [(3R,5R,6S)-3,4,5-triacetyloxy-6-[[5-(naphthalene-2-carbonyl)-1,3-thiazol-2-yl]amino]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1O[C@H](Nc2ncc(C(=O)c3ccc4ccccc4c3)s2)[C@H](OC(C)=O)C(OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C28H28N2O10S/c1-14(31)36-13-21-24(37-15(2)32)25(38-16(3)33)26(39-17(4)34)27(40-21)30-28-29-12-22(41-28)23(35)20-10-9-18-7-5-6-8-19(18)11-20/h5-12,21,24-27H,13H2,1-4H3,(H,29,30)/t21?,24-,25?,26-,27+/m1/s1 |
| InChIKey | QUMDNUIRBHKIEI-OINHGORCSA-N |
| XLogP | 3.02 |
| TPSA | 156.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.60 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|