C26H27N3O11 — CID 136746134
[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[[3-(1H-indol-2-yl)-1,2-oxazole-5-carbonyl]amino]oxan-2-yl]methyl acetate (PubChem CID 136746134) has the molecular formula C26H27N3O11 and a molecular weight of 557.51 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[[3-(1H-indol-2-yl)-1,2-oxazole-5-carbonyl]amino]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[[3-(1H-indol-2-yl)-1,2-oxazole-5-carbonyl]amino]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 136746134 |
| Molecular Formula | C26H27N3O11 |
| Molecular Weight | 557.51 g/mol |
| Exact Mass | 557.16 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[[3-(1H-indol-2-yl)-1,2-oxazole-5-carbonyl]amino]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](NC(=O)c2cc(-c3cc4ccccc4[nH]3)no2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C26H27N3O11/c1-12(30)35-11-21-22(36-13(2)31)23(37-14(3)32)24(38-15(4)33)26(39-21)28-25(34)20-10-19(29-40-20)18-9-16-7-5-6-8-17(16)27-18/h5-10,21-24,26-27H,11H2,1-4H3,(H,28,34)/t21-,22-,23+,24-,26-/m1/s1 |
| InChIKey | URAFFRLWVACWLU-HROMDODWSA-N |
| XLogP | 1.64 |
| TPSA | 185.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.51 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|