C23H25ArN3O6S — CID 160822391
[(3S,4S,6S)-5-acetyloxy-6-[[5-(4-isocyanobenzoyl)-1,3-thiazol-2-yl]amino]-3,4-dimethyloxan-2-yl]methyl acetate;argon (PubChem CID 160822391) has the molecular formula C23H25ArN3O6S and a molecular weight of 511.48 g/mol. Its IUPAC name is [(3S,4S,6S)-5-acetyloxy-6-[[5-(4-isocyanobenzoyl)-1,3-thiazol-2-yl]amino]-3,4-dimethyloxan-2-yl]methyl acetate;argon.
| Compound Name | [(3S,4S,6S)-5-acetyloxy-6-[[5-(4-isocyanobenzoyl)-1,3-thiazol-2-yl]amino]-3,4-dimethyloxan-2-yl]methyl acetate;argon |
|---|---|
| PubChem CID | 160822391 |
| Molecular Formula | C23H25ArN3O6S |
| Molecular Weight | 511.48 g/mol |
| Exact Mass | 511.11 |
| IUPAC Name | [(3S,4S,6S)-5-acetyloxy-6-[[5-(4-isocyanobenzoyl)-1,3-thiazol-2-yl]amino]-3,4-dimethyloxan-2-yl]methyl acetate;argon |
| SMILES | [Ar].[C-]#[N+]c1ccc(C(=O)c2cnc(N[C@H]3OC(COC(C)=O)[C@@H](C)[C@H](C)C3OC(C)=O)s2)cc1 |
| InChI | InChI=1S/C23H25N3O6S.Ar/c1-12-13(2)21(31-15(4)28)22(32-18(12)11-30-14(3)27)26-23-25-10-19(33-23)20(29)16-6-8-17(24-5)9-7-16;/h6-10,12-13,18,21-22H,11H2,1-4H3,(H,25,26);/t12-,13-,18?,21?,22-;/m0./s1 |
| InChIKey | SFSGKUSDRUPANM-RVPCRLINSA-N |
| XLogP | 3.83 |
| TPSA | 108.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.48 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|