C24H26N2O10S — CID 141402829
2-[[(2R,3R,4S,5S)-6-[(5-benzoyl-1,3-thiazol-2-yl)amino]-3,4,5-tris(2-deuterio-2-oxoethoxy)oxan-2-yl]methoxy]-1-deuterioethanone (PubChem CID 141402829) has the molecular formula C24H26N2O10S and a molecular weight of 538.57 g/mol. Its IUPAC name is 2-[[(2R,3R,4S,5S)-6-[(5-benzoyl-1,3-thiazol-2-yl)amino]-3,4,5-tris(2-deuterio-2-oxoethoxy)oxan-2-yl]methoxy]-1-deuterioethanone.
| Compound Name | 2-[[(2R,3R,4S,5S)-6-[(5-benzoyl-1,3-thiazol-2-yl)amino]-3,4,5-tris(2-deuterio-2-oxoethoxy)oxan-2-yl]methoxy]-1-deuterioethanone |
|---|---|
| PubChem CID | 141402829 |
| Molecular Formula | C24H26N2O10S |
| Molecular Weight | 538.57 g/mol |
| Exact Mass | 538.16 |
| IUPAC Name | 2-[[(2R,3R,4S,5S)-6-[(5-benzoyl-1,3-thiazol-2-yl)amino]-3,4,5-tris(2-deuterio-2-oxoethoxy)oxan-2-yl]methoxy]-1-deuterioethanone |
| SMILES | [2H]C(=O)COC[C@H]1OC(Nc2ncc(C(=O)c3ccccc3)s2)[C@@H](OCC([2H])=O)[C@@H](OCC([2H])=O)[C@@H]1OCC([2H])=O |
| InChI | InChI=1S/C24H26N2O10S/c27-6-10-32-15-17-20(33-11-7-28)21(34-12-8-29)22(35-13-9-30)23(36-17)26-24-25-14-18(37-24)19(31)16-4-2-1-3-5-16/h1-9,14,17,20-23H,10-13,15H2,(H,25,26)/t17-,20-,21+,22+,23?/m1/s1/i6D,7D,8D,9D |
| InChIKey | NHMHNXLUNHUVJK-RZIDVELTSA-N |
| XLogP | 0.48 |
| TPSA | 156.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.57 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|