C16H18ArN2O6S — CID 158841854
argon;phenyl-[2-[[(2S,4S,5S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]amino]-1,3-thiazol-5-yl]methanone (PubChem CID 158841854) has the molecular formula C16H18ArN2O6S and a molecular weight of 406.34 g/mol. Its IUPAC name is argon;phenyl-[2-[[(2S,4S,5S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]amino]-1,3-thiazol-5-yl]methanone.
| Compound Name | argon;phenyl-[2-[[(2S,4S,5S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]amino]-1,3-thiazol-5-yl]methanone |
|---|---|
| PubChem CID | 158841854 |
| Molecular Formula | C16H18ArN2O6S |
| Molecular Weight | 406.34 g/mol |
| Exact Mass | 406.05 |
| IUPAC Name | argon;phenyl-[2-[[(2S,4S,5S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]amino]-1,3-thiazol-5-yl]methanone |
| SMILES | O=C(c1ccccc1)c1cnc(N[C@H]2OC(CO)[C@@H](O)[C@H](O)C2O)s1.[Ar] |
| InChI | InChI=1S/C16H18N2O6S.Ar/c19-7-9-12(21)13(22)14(23)15(24-9)18-16-17-6-10(25-16)11(20)8-4-2-1-3-5-8;/h1-6,9,12-15,19,21-23H,7H2,(H,17,18);/t9?,12-,13+,14?,15+;/m1./s1 |
| InChIKey | IYIPYPFIASEWFR-XEILSWMOSA-N |
| XLogP | -0.41 |
| TPSA | 132.14 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.34 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |