C20H20N2O6S — CID 71746043
naphthalen-2-yl-[2-[[(2S,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]amino]-1,3-thiazol-5-yl]methanone (PubChem CID 71746043) has the molecular formula C20H20N2O6S and a molecular weight of 416.46 g/mol. Its IUPAC name is naphthalen-2-yl-[2-[[(2S,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]amino]-1,3-thiazol-5-yl]methanone.
| Compound Name | naphthalen-2-yl-[2-[[(2S,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]amino]-1,3-thiazol-5-yl]methanone |
|---|---|
| PubChem CID | 71746043 |
| Molecular Formula | C20H20N2O6S |
| Molecular Weight | 416.46 g/mol |
| Exact Mass | 416.10 |
| IUPAC Name | naphthalen-2-yl-[2-[[(2S,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]amino]-1,3-thiazol-5-yl]methanone |
| SMILES | O=C(c1ccc2ccccc2c1)c1cnc(N[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]2O)s1 |
| InChI | InChI=1S/C20H20N2O6S/c23-9-13-16(25)17(26)18(27)19(28-13)22-20-21-8-14(29-20)15(24)12-6-5-10-3-1-2-4-11(10)7-12/h1-8,13,16-19,23,25-27H,9H2,(H,21,22)/t13-,16-,17+,18+,19+/m1/s1 |
| InChIKey | DGCWVEOHKMAFTM-UVMNYOIOSA-N |
| XLogP | 0.74 |
| TPSA | 132.14 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.46 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |