C28H29ClO12 — CID 141412819
methyl 4-[3-chloro-4-[(3S,4S,5R,6R)-3,4,5-tris(2-deuterio-2-oxoethoxy)-6-[(2-deuterio-2-oxoethoxy)methyl]oxan-2-yl]oxyphenyl]benzoate (PubChem CID 141412819) has the molecular formula C28H29ClO12 and a molecular weight of 597.01 g/mol. Its IUPAC name is methyl 4-[3-chloro-4-[(3S,4S,5R,6R)-3,4,5-tris(2-deuterio-2-oxoethoxy)-6-[(2-deuterio-2-oxoethoxy)methyl]oxan-2-yl]oxyphenyl]benzoate.
| Compound Name | methyl 4-[3-chloro-4-[(3S,4S,5R,6R)-3,4,5-tris(2-deuterio-2-oxoethoxy)-6-[(2-deuterio-2-oxoethoxy)methyl]oxan-2-yl]oxyphenyl]benzoate |
|---|---|
| PubChem CID | 141412819 |
| Molecular Formula | C28H29ClO12 |
| Molecular Weight | 597.01 g/mol |
| Exact Mass | 596.16 |
| IUPAC Name | methyl 4-[3-chloro-4-[(3S,4S,5R,6R)-3,4,5-tris(2-deuterio-2-oxoethoxy)-6-[(2-deuterio-2-oxoethoxy)methyl]oxan-2-yl]oxyphenyl]benzoate |
| SMILES | [2H]C(=O)COC[C@H]1OC(Oc2ccc(-c3ccc(C(=O)OC)cc3)cc2Cl)[C@@H](OCC([2H])=O)[C@@H](OCC([2H])=O)[C@@H]1OCC([2H])=O |
| InChI | InChI=1S/C28H29ClO12/c1-35-27(34)19-4-2-18(3-5-19)20-6-7-22(21(29)16-20)40-28-26(39-15-11-33)25(38-14-10-32)24(37-13-9-31)23(41-28)17-36-12-8-30/h2-11,16,23-26,28H,12-15,17H2,1H3/t23-,24-,25+,26+,28?/m1/s1/i8D,9D,10D,11D |
| InChIKey | DKCZMLJJLFNYMU-DTFLACNOSA-N |
| XLogP | 1.87 |
| TPSA | 149.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.01 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|