C19H21F3N2O10S — CID 141402824
2,2,2-trifluoro-1-[2-[[(3S,4S,5R,6R)-3,4,5-tris(2-deuterio-2-oxoethoxy)-6-[(2-deuterio-2-oxoethoxy)methyl]oxan-2-yl]amino]-1,3-thiazol-5-yl]ethanone (PubChem CID 141402824) has the molecular formula C19H21F3N2O10S and a molecular weight of 530.47 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-[2-[[(3S,4S,5R,6R)-3,4,5-tris(2-deuterio-2-oxoethoxy)-6-[(2-deuterio-2-oxoethoxy)methyl]oxan-2-yl]amino]-1,3-thiazol-5-yl]ethanone.
| Compound Name | 2,2,2-trifluoro-1-[2-[[(3S,4S,5R,6R)-3,4,5-tris(2-deuterio-2-oxoethoxy)-6-[(2-deuterio-2-oxoethoxy)methyl]oxan-2-yl]amino]-1,3-thiazol-5-yl]ethanone |
|---|---|
| PubChem CID | 141402824 |
| Molecular Formula | C19H21F3N2O10S |
| Molecular Weight | 530.47 g/mol |
| Exact Mass | 530.11 |
| IUPAC Name | 2,2,2-trifluoro-1-[2-[[(3S,4S,5R,6R)-3,4,5-tris(2-deuterio-2-oxoethoxy)-6-[(2-deuterio-2-oxoethoxy)methyl]oxan-2-yl]amino]-1,3-thiazol-5-yl]ethanone |
| SMILES | [2H]C(=O)COC[C@H]1OC(Nc2ncc(C(=O)C(F)(F)F)s2)[C@@H](OCC([2H])=O)[C@@H](OCC([2H])=O)[C@@H]1OCC([2H])=O |
| InChI | InChI=1S/C19H21F3N2O10S/c20-19(21,22)16(29)12-9-23-18(35-12)24-17-15(33-8-4-28)14(32-7-3-27)13(31-6-2-26)11(34-17)10-30-5-1-25/h1-4,9,11,13-15,17H,5-8,10H2,(H,23,24)/t11-,13-,14+,15+,17?/m1/s1/i1D,2D,3D,4D |
| InChIKey | PJGISDBOUUWFAX-UMUCXFASSA-N |
| XLogP | -0.01 |
| TPSA | 156.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.47 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|