C19H26N2O9S — CID 141402825
1-deuterio-2-[[(2R,3R,4S,5S)-3,4,5-tris(2-deuterio-2-oxoethoxy)-6-(4-methylsulfanyl-2H-pyrimidin-1-yl)oxan-2-yl]methoxy]ethanone (PubChem CID 141402825) has the molecular formula C19H26N2O9S and a molecular weight of 462.51 g/mol. Its IUPAC name is 1-deuterio-2-[[(2R,3R,4S,5S)-3,4,5-tris(2-deuterio-2-oxoethoxy)-6-(4-methylsulfanyl-2H-pyrimidin-1-yl)oxan-2-yl]methoxy]ethanone.
| Compound Name | 1-deuterio-2-[[(2R,3R,4S,5S)-3,4,5-tris(2-deuterio-2-oxoethoxy)-6-(4-methylsulfanyl-2H-pyrimidin-1-yl)oxan-2-yl]methoxy]ethanone |
|---|---|
| PubChem CID | 141402825 |
| Molecular Formula | C19H26N2O9S |
| Molecular Weight | 462.51 g/mol |
| Exact Mass | 462.16 |
| IUPAC Name | 1-deuterio-2-[[(2R,3R,4S,5S)-3,4,5-tris(2-deuterio-2-oxoethoxy)-6-(4-methylsulfanyl-2H-pyrimidin-1-yl)oxan-2-yl]methoxy]ethanone |
| SMILES | [2H]C(=O)COC[C@H]1OC(N2C=CC(SC)=NC2)[C@@H](OCC([2H])=O)[C@@H](OCC([2H])=O)[C@@H]1OCC([2H])=O |
| InChI | InChI=1S/C19H26N2O9S/c1-31-15-2-3-21(13-20-15)19-18(29-11-7-25)17(28-10-6-24)16(27-9-5-23)14(30-19)12-26-8-4-22/h2-7,14,16-19H,8-13H2,1H3/t14-,16-,17+,18+,19?/m1/s1/i4D,5D,6D,7D |
| InChIKey | YYMGFQKUMGOIBB-NSUOAVDLSA-N |
| XLogP | -0.77 |
| TPSA | 130.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.51 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|