C20H24N4O8S2 — CID 122234276
[(2R,3S,4R,5R,6R)-5-acetamido-3,4-diacetyloxy-6-[(5-thiophen-2-yl-1,3,4-thiadiazol-2-yl)amino]oxan-2-yl]methyl acetate (PubChem CID 122234276) has the molecular formula C20H24N4O8S2 and a molecular weight of 512.57 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6R)-5-acetamido-3,4-diacetyloxy-6-[(5-thiophen-2-yl-1,3,4-thiadiazol-2-yl)amino]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5R,6R)-5-acetamido-3,4-diacetyloxy-6-[(5-thiophen-2-yl-1,3,4-thiadiazol-2-yl)amino]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 122234276 |
| Molecular Formula | C20H24N4O8S2 |
| Molecular Weight | 512.57 g/mol |
| Exact Mass | 512.10 |
| IUPAC Name | [(2R,3S,4R,5R,6R)-5-acetamido-3,4-diacetyloxy-6-[(5-thiophen-2-yl-1,3,4-thiadiazol-2-yl)amino]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)N[C@@H]1[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](COC(C)=O)O[C@H]1Nc1nnc(-c2cccs2)s1 |
| InChI | InChI=1S/C20H24N4O8S2/c1-9(25)21-15-17(31-12(4)28)16(30-11(3)27)13(8-29-10(2)26)32-18(15)22-20-24-23-19(34-20)14-6-5-7-33-14/h5-7,13,15-18H,8H2,1-4H3,(H,21,25)(H,22,24)/t13-,15-,16-,17-,18-/m1/s1 |
| InChIKey | OQMZZVUFRUFWGW-JVNHZCFISA-N |
| XLogP | 1.33 |
| TPSA | 155.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.57 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|