C24H26O11S — CID 122389490
[(2R,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-naphthalen-2-ylsulfonyloxan-2-yl]methyl acetate (PubChem CID 122389490) has the molecular formula C24H26O11S and a molecular weight of 522.53 g/mol. Its IUPAC name is [(2R,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-naphthalen-2-ylsulfonyloxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-naphthalen-2-ylsulfonyloxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 122389490 |
| Molecular Formula | C24H26O11S |
| Molecular Weight | 522.53 g/mol |
| Exact Mass | 522.12 |
| IUPAC Name | [(2R,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-naphthalen-2-ylsulfonyloxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@H](S(=O)(=O)c2ccc3ccccc3c2)[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C24H26O11S/c1-13(25)31-12-20-21(32-14(2)26)22(33-15(3)27)23(34-16(4)28)24(35-20)36(29,30)19-10-9-17-7-5-6-8-18(17)11-19/h5-11,20-24H,12H2,1-4H3/t20-,21-,22+,23+,24-/m1/s1 |
| InChIKey | HMKJAIPAWLWGEV-URYYLNOGSA-N |
| XLogP | 1.70 |
| TPSA | 148.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.53 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|