C22H24O7S — CID 102151354
[(2R,3S,4R,6R)-3,4-diacetyloxy-6-naphthalen-2-ylsulfanyloxan-2-yl]methyl acetate (PubChem CID 102151354) has the molecular formula C22H24O7S and a molecular weight of 432.49 g/mol. Its IUPAC name is [(2R,3S,4R,6R)-3,4-diacetyloxy-6-naphthalen-2-ylsulfanyloxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,6R)-3,4-diacetyloxy-6-naphthalen-2-ylsulfanyloxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 102151354 |
| Molecular Formula | C22H24O7S |
| Molecular Weight | 432.49 g/mol |
| Exact Mass | 432.12 |
| IUPAC Name | [(2R,3S,4R,6R)-3,4-diacetyloxy-6-naphthalen-2-ylsulfanyloxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@H](Sc2ccc3ccccc3c2)C[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C22H24O7S/c1-13(23)26-12-20-22(28-15(3)25)19(27-14(2)24)11-21(29-20)30-18-9-8-16-6-4-5-7-17(16)10-18/h4-10,19-22H,11-12H2,1-3H3/t19-,20-,21-,22+/m1/s1 |
| InChIKey | ZJYMLNODHGATHS-YSFYHYPLSA-N |
| XLogP | 3.47 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.49 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|