C19H26NO10S+ — CID 142403108
acetic acid;[3,4-diacetyloxy-6-(1-hydroxypyridin-1-ium-2-yl)sulfanyloxan-2-yl]methyl acetate (PubChem CID 142403108) has the molecular formula C19H26NO10S+ and a molecular weight of 460.48 g/mol. Its IUPAC name is acetic acid;[3,4-diacetyloxy-6-(1-hydroxypyridin-1-ium-2-yl)sulfanyloxan-2-yl]methyl acetate.
| Compound Name | acetic acid;[3,4-diacetyloxy-6-(1-hydroxypyridin-1-ium-2-yl)sulfanyloxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 142403108 |
| Molecular Formula | C19H26NO10S+ |
| Molecular Weight | 460.48 g/mol |
| Exact Mass | 460.13 |
| IUPAC Name | acetic acid;[3,4-diacetyloxy-6-(1-hydroxypyridin-1-ium-2-yl)sulfanyloxan-2-yl]methyl acetate |
| SMILES | CC(=O)O.CC(=O)OCC1OC(Sc2cccc[n+]2O)CC(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C17H22NO8S.C2H4O2/c1-10(19)23-9-14-17(25-12(3)21)13(24-11(2)20)8-16(26-14)27-15-6-4-5-7-18(15)22;1-2(3)4/h4-7,13-14,16-17,22H,8-9H2,1-3H3;1H3,(H,3,4)/q+1; |
| InChIKey | WROJIFXGPIWVLK-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 149.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.48 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|