C22H27NO11S — CID 100943455
[(2R,3S,4R,5R,6S)-3,4-diacetyloxy-6-(benzenesulfonyl)-5-(prop-2-enoxycarbonylamino)oxan-2-yl]methyl acetate (PubChem CID 100943455) has the molecular formula C22H27NO11S and a molecular weight of 513.52 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6S)-3,4-diacetyloxy-6-(benzenesulfonyl)-5-(prop-2-enoxycarbonylamino)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5R,6S)-3,4-diacetyloxy-6-(benzenesulfonyl)-5-(prop-2-enoxycarbonylamino)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 100943455 |
| Molecular Formula | C22H27NO11S |
| Molecular Weight | 513.52 g/mol |
| Exact Mass | 513.13 |
| IUPAC Name | [(2R,3S,4R,5R,6S)-3,4-diacetyloxy-6-(benzenesulfonyl)-5-(prop-2-enoxycarbonylamino)oxan-2-yl]methyl acetate |
| SMILES | C=CCOC(=O)N[C@@H]1[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](COC(C)=O)O[C@H]1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C22H27NO11S/c1-5-11-30-22(27)23-18-20(33-15(4)26)19(32-14(3)25)17(12-31-13(2)24)34-21(18)35(28,29)16-9-7-6-8-10-16/h5-10,17-21H,1,11-12H2,2-4H3,(H,23,27)/t17-,18-,19-,20-,21+/m1/s1 |
| InChIKey | RHTDFBLGSSYWDX-ONUIULTDSA-N |
| XLogP | 0.89 |
| TPSA | 160.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.52 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|