C29H37Cl3N2O13 — CID 68843831
[(2R,3S,4R,5S,6S)-3,4-diacetyloxy-6-[(2R)-3-phenylmethoxy-2-(prop-2-enoxycarbonylamino)propoxy]-5-(2,2,2-trichloroethoxycarbonylamino)oxan-2-yl]methyl acetate (PubChem CID 68843831) has the molecular formula C29H37Cl3N2O13 and a molecular weight of 727.97 g/mol. Its IUPAC name is [(2R,3S,4R,5S,6S)-3,4-diacetyloxy-6-[(2R)-3-phenylmethoxy-2-(prop-2-enoxycarbonylamino)propoxy]-5-(2,2,2-trichloroethoxycarbonylamino)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5S,6S)-3,4-diacetyloxy-6-[(2R)-3-phenylmethoxy-2-(prop-2-enoxycarbonylamino)propoxy]-5-(2,2,2-trichloroethoxycarbonylamino)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 68843831 |
| Molecular Formula | C29H37Cl3N2O13 |
| Molecular Weight | 727.97 g/mol |
| Exact Mass | 726.14 |
| IUPAC Name | [(2R,3S,4R,5S,6S)-3,4-diacetyloxy-6-[(2R)-3-phenylmethoxy-2-(prop-2-enoxycarbonylamino)propoxy]-5-(2,2,2-trichloroethoxycarbonylamino)oxan-2-yl]methyl acetate |
| SMILES | C=CCOC(=O)N[C@H](COCc1ccccc1)CO[C@H]1O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H]1NC(=O)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C29H37Cl3N2O13/c1-5-11-41-27(38)33-21(13-40-12-20-9-7-6-8-10-20)14-43-26-23(34-28(39)44-16-29(30,31)32)25(46-19(4)37)24(45-18(3)36)22(47-26)15-42-17(2)35/h5-10,21-26H,1,11-16H2,2-4H3,(H,33,38)(H,34,39)/t21-,22-,23+,24-,25-,26+/m1/s1 |
| InChIKey | YSBNMKRUSXQBMD-GOOFPYJASA-N |
| XLogP | 3.12 |
| TPSA | 183.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.97 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|