C23H31Cl3N2O14 — CID 10897661
methyl (2S)-3-[(2R,3R,4R,5S,6R)-4,5-diacetyloxy-6-(acetyloxymethyl)-3-(prop-2-enoxycarbonylamino)oxan-2-yl]oxy-2-(2,2,2-trichloroethoxycarbonylamino)propanoate (PubChem CID 10897661) has the molecular formula C23H31Cl3N2O14 and a molecular weight of 665.86 g/mol. Its IUPAC name is methyl (2S)-3-[(2R,3R,4R,5S,6R)-4,5-diacetyloxy-6-(acetyloxymethyl)-3-(prop-2-enoxycarbonylamino)oxan-2-yl]oxy-2-(2,2,2-trichloroethoxycarbonylamino)propanoate.
| Compound Name | methyl (2S)-3-[(2R,3R,4R,5S,6R)-4,5-diacetyloxy-6-(acetyloxymethyl)-3-(prop-2-enoxycarbonylamino)oxan-2-yl]oxy-2-(2,2,2-trichloroethoxycarbonylamino)propanoate |
|---|---|
| PubChem CID | 10897661 |
| Molecular Formula | C23H31Cl3N2O14 |
| Molecular Weight | 665.86 g/mol |
| Exact Mass | 664.08 |
| IUPAC Name | methyl (2S)-3-[(2R,3R,4R,5S,6R)-4,5-diacetyloxy-6-(acetyloxymethyl)-3-(prop-2-enoxycarbonylamino)oxan-2-yl]oxy-2-(2,2,2-trichloroethoxycarbonylamino)propanoate |
| SMILES | C=CCOC(=O)N[C@H]1[C@H](OC[C@H](NC(=O)OCC(Cl)(Cl)Cl)C(=O)OC)O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C23H31Cl3N2O14/c1-6-7-36-22(34)28-16-18(41-13(4)31)17(40-12(3)30)15(9-37-11(2)29)42-20(16)38-8-14(19(32)35-5)27-21(33)39-10-23(24,25)26/h6,14-18,20H,1,7-10H2,2-5H3,(H,27,33)(H,28,34)/t14-,15+,16+,17+,18+,20+/m0/s1 |
| InChIKey | LLOCXZGLXJFGOC-UMCYSPNLSA-N |
| XLogP | 1.07 |
| TPSA | 200.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.86 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|