C22H30Cl3NO14 — CID 14825560
dimethyl 3-[(2S,3R,4R,5S,6R)-4,5-diacetyloxy-6-(acetyloxymethyl)-3-(2,2,2-trichloroethoxycarbonylamino)oxan-2-yl]oxypentanedioate (PubChem CID 14825560) has the molecular formula C22H30Cl3NO14 and a molecular weight of 638.83 g/mol. Its IUPAC name is dimethyl 3-[(2S,3R,4R,5S,6R)-4,5-diacetyloxy-6-(acetyloxymethyl)-3-(2,2,2-trichloroethoxycarbonylamino)oxan-2-yl]oxypentanedioate.
| Compound Name | dimethyl 3-[(2S,3R,4R,5S,6R)-4,5-diacetyloxy-6-(acetyloxymethyl)-3-(2,2,2-trichloroethoxycarbonylamino)oxan-2-yl]oxypentanedioate |
|---|---|
| PubChem CID | 14825560 |
| Molecular Formula | C22H30Cl3NO14 |
| Molecular Weight | 638.83 g/mol |
| Exact Mass | 637.07 |
| IUPAC Name | dimethyl 3-[(2S,3R,4R,5S,6R)-4,5-diacetyloxy-6-(acetyloxymethyl)-3-(2,2,2-trichloroethoxycarbonylamino)oxan-2-yl]oxypentanedioate |
| SMILES | COC(=O)CC(CC(=O)OC)O[C@H]1O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1NC(=O)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C22H30Cl3NO14/c1-10(27)35-8-14-18(37-11(2)28)19(38-12(3)29)17(26-21(32)36-9-22(23,24)25)20(40-14)39-13(6-15(30)33-4)7-16(31)34-5/h13-14,17-20H,6-9H2,1-5H3,(H,26,32)/t14-,17-,18-,19-,20+/m1/s1 |
| InChIKey | XBXHHGMHCLLCTB-CBFGRJNTSA-N |
| XLogP | 1.11 |
| TPSA | 188.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.83 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|