C22H28Cl6N2O14 — CID 14825574
methyl (2S)-3-[(2R,3R,4R,5S,6R)-4,5-diacetyloxy-6-(acetyloxymethyl)-3-(2,2,2-trichloroethoxycarbonylamino)oxan-2-yl]oxy-2-(2,2,2-trichloroethoxycarbonylamino)propanoate (PubChem CID 14825574) has the molecular formula C22H28Cl6N2O14 and a molecular weight of 757.18 g/mol. Its IUPAC name is methyl (2S)-3-[(2R,3R,4R,5S,6R)-4,5-diacetyloxy-6-(acetyloxymethyl)-3-(2,2,2-trichloroethoxycarbonylamino)oxan-2-yl]oxy-2-(2,2,2-trichloroethoxycarbonylamino)propanoate.
| Compound Name | methyl (2S)-3-[(2R,3R,4R,5S,6R)-4,5-diacetyloxy-6-(acetyloxymethyl)-3-(2,2,2-trichloroethoxycarbonylamino)oxan-2-yl]oxy-2-(2,2,2-trichloroethoxycarbonylamino)propanoate |
|---|---|
| PubChem CID | 14825574 |
| Molecular Formula | C22H28Cl6N2O14 |
| Molecular Weight | 757.18 g/mol |
| Exact Mass | 753.97 |
| IUPAC Name | methyl (2S)-3-[(2R,3R,4R,5S,6R)-4,5-diacetyloxy-6-(acetyloxymethyl)-3-(2,2,2-trichloroethoxycarbonylamino)oxan-2-yl]oxy-2-(2,2,2-trichloroethoxycarbonylamino)propanoate |
| SMILES | COC(=O)[C@H](CO[C@@H]1O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1NC(=O)OCC(Cl)(Cl)Cl)NC(=O)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C22H28Cl6N2O14/c1-9(31)38-6-13-15(42-10(2)32)16(43-11(3)33)14(30-20(36)41-8-22(26,27)28)18(44-13)39-5-12(17(34)37-4)29-19(35)40-7-21(23,24)25/h12-16,18H,5-8H2,1-4H3,(H,29,35)(H,30,36)/t12-,13+,14+,15+,16+,18+/m0/s1 |
| InChIKey | CCMXTTBWLHBFEZ-DGYIVEFISA-N |
| XLogP | 2.26 |
| TPSA | 200.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.18 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|