C19H25Cl4NO12 — CID 102162549
methyl 2-chloro-3-[(2R,3R,4R,5S,6R)-4,5-diacetyloxy-6-(acetyloxymethyl)-3-(2,2,2-trichloroethoxycarbonylamino)oxan-2-yl]oxypropanoate (PubChem CID 102162549) has the molecular formula C19H25Cl4NO12 and a molecular weight of 601.22 g/mol. Its IUPAC name is methyl 2-chloro-3-[(2R,3R,4R,5S,6R)-4,5-diacetyloxy-6-(acetyloxymethyl)-3-(2,2,2-trichloroethoxycarbonylamino)oxan-2-yl]oxypropanoate.
| Compound Name | methyl 2-chloro-3-[(2R,3R,4R,5S,6R)-4,5-diacetyloxy-6-(acetyloxymethyl)-3-(2,2,2-trichloroethoxycarbonylamino)oxan-2-yl]oxypropanoate |
|---|---|
| PubChem CID | 102162549 |
| Molecular Formula | C19H25Cl4NO12 |
| Molecular Weight | 601.22 g/mol |
| Exact Mass | 599.01 |
| IUPAC Name | methyl 2-chloro-3-[(2R,3R,4R,5S,6R)-4,5-diacetyloxy-6-(acetyloxymethyl)-3-(2,2,2-trichloroethoxycarbonylamino)oxan-2-yl]oxypropanoate |
| SMILES | COC(=O)C(Cl)CO[C@@H]1O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1NC(=O)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C19H25Cl4NO12/c1-8(25)31-6-12-14(34-9(2)26)15(35-10(3)27)13(24-18(29)33-7-19(21,22)23)17(36-12)32-5-11(20)16(28)30-4/h11-15,17H,5-7H2,1-4H3,(H,24,29)/t11?,12-,13-,14-,15-,17-/m1/s1 |
| InChIKey | WEMNXRHAKYXPDV-GAEBJVAZSA-N |
| XLogP | 1.40 |
| TPSA | 161.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.22 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|