C21H31NO11S — CID 22298273
methyl 4-[4,5-diacetyloxy-6-(acetyloxymethyl)-3-(prop-2-enoxycarbonylamino)oxan-2-yl]sulfanylbutanoate (PubChem CID 22298273) has the molecular formula C21H31NO11S and a molecular weight of 505.54 g/mol. Its IUPAC name is methyl 4-[4,5-diacetyloxy-6-(acetyloxymethyl)-3-(prop-2-enoxycarbonylamino)oxan-2-yl]sulfanylbutanoate.
| Compound Name | methyl 4-[4,5-diacetyloxy-6-(acetyloxymethyl)-3-(prop-2-enoxycarbonylamino)oxan-2-yl]sulfanylbutanoate |
|---|---|
| PubChem CID | 22298273 |
| Molecular Formula | C21H31NO11S |
| Molecular Weight | 505.54 g/mol |
| Exact Mass | 505.16 |
| IUPAC Name | methyl 4-[4,5-diacetyloxy-6-(acetyloxymethyl)-3-(prop-2-enoxycarbonylamino)oxan-2-yl]sulfanylbutanoate |
| SMILES | C=CCOC(=O)NC1C(SCCCC(=O)OC)OC(COC(C)=O)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C21H31NO11S/c1-6-9-29-21(27)22-17-19(32-14(4)25)18(31-13(3)24)15(11-30-12(2)23)33-20(17)34-10-7-8-16(26)28-5/h6,15,17-20H,1,7-11H2,2-5H3,(H,22,27) |
| InChIKey | JODXOSAKJLFMTN-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 152.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.54 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|