C18H27NO10S2 — CID 139262900
[(2R,3S,4R,5R,6S)-5-acetamido-3,4-diacetyloxy-6-(2-ethenylsulfonylethylsulfanyl)oxan-2-yl]methyl acetate (PubChem CID 139262900) has the molecular formula C18H27NO10S2 and a molecular weight of 481.55 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6S)-5-acetamido-3,4-diacetyloxy-6-(2-ethenylsulfonylethylsulfanyl)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5R,6S)-5-acetamido-3,4-diacetyloxy-6-(2-ethenylsulfonylethylsulfanyl)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 139262900 |
| Molecular Formula | C18H27NO10S2 |
| Molecular Weight | 481.55 g/mol |
| Exact Mass | 481.11 |
| IUPAC Name | [(2R,3S,4R,5R,6S)-5-acetamido-3,4-diacetyloxy-6-(2-ethenylsulfonylethylsulfanyl)oxan-2-yl]methyl acetate |
| SMILES | C=CS(=O)(=O)CCS[C@@H]1O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1NC(C)=O |
| InChI | InChI=1S/C18H27NO10S2/c1-6-31(24,25)8-7-30-18-15(19-10(2)20)17(28-13(5)23)16(27-12(4)22)14(29-18)9-26-11(3)21/h6,14-18H,1,7-9H2,2-5H3,(H,19,20)/t14-,15-,16-,17-,18+/m1/s1 |
| InChIKey | WIRIHTZPTSEZCH-ZKXLYKBJSA-N |
| XLogP | -0.07 |
| TPSA | 151.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.55 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|