C17H24ClNO8 — CID 10811287
[(2R,3S,4R,5R,6R)-3,4-diacetyloxy-6-chloro-5-(pent-4-enoylamino)oxan-2-yl]methyl acetate (PubChem CID 10811287) has the molecular formula C17H24ClNO8 and a molecular weight of 405.83 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6R)-3,4-diacetyloxy-6-chloro-5-(pent-4-enoylamino)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5R,6R)-3,4-diacetyloxy-6-chloro-5-(pent-4-enoylamino)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 10811287 |
| Molecular Formula | C17H24ClNO8 |
| Molecular Weight | 405.83 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | [(2R,3S,4R,5R,6R)-3,4-diacetyloxy-6-chloro-5-(pent-4-enoylamino)oxan-2-yl]methyl acetate |
| SMILES | C=CCCC(=O)N[C@@H]1[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](COC(C)=O)O[C@@H]1Cl |
| InChI | InChI=1S/C17H24ClNO8/c1-5-6-7-13(23)19-14-16(26-11(4)22)15(25-10(3)21)12(27-17(14)18)8-24-9(2)20/h5,12,14-17H,1,6-8H2,2-4H3,(H,19,23)/t12-,14-,15-,16-,17+/m1/s1 |
| InChIKey | NYWHDXHJKBYHMY-NHMWIVBRSA-N |
| XLogP | 0.83 |
| TPSA | 117.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.83 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|