C25H33NO10 — CID 10767912
[(2R,3S,4R,5R,6R)-3,4-diacetyloxy-6-[(4-methoxyphenyl)methoxy]-5-(pent-4-enoylamino)oxan-2-yl]methyl acetate (PubChem CID 10767912) has the molecular formula C25H33NO10 and a molecular weight of 507.54 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6R)-3,4-diacetyloxy-6-[(4-methoxyphenyl)methoxy]-5-(pent-4-enoylamino)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5R,6R)-3,4-diacetyloxy-6-[(4-methoxyphenyl)methoxy]-5-(pent-4-enoylamino)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 10767912 |
| Molecular Formula | C25H33NO10 |
| Molecular Weight | 507.54 g/mol |
| Exact Mass | 507.21 |
| IUPAC Name | [(2R,3S,4R,5R,6R)-3,4-diacetyloxy-6-[(4-methoxyphenyl)methoxy]-5-(pent-4-enoylamino)oxan-2-yl]methyl acetate |
| SMILES | C=CCCC(=O)N[C@H]1[C@H](OCc2ccc(OC)cc2)O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C25H33NO10/c1-6-7-8-21(30)26-22-24(35-17(4)29)23(34-16(3)28)20(14-32-15(2)27)36-25(22)33-13-18-9-11-19(31-5)12-10-18/h6,9-12,20,22-25H,1,7-8,13-14H2,2-5H3,(H,26,30)/t20-,22-,23-,24-,25-/m1/s1 |
| InChIKey | WVJUVROUONVTQL-KUEHFBCJSA-N |
| XLogP | 1.81 |
| TPSA | 135.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.54 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|