C30H41N3O11 — CID 11628729
[(2R,3S,4R,5R)-5-acetamido-3,4-diacetyloxy-6-[[4-[6-(prop-2-enoylamino)hexanoylamino]phenyl]methoxy]oxan-2-yl]methyl acetate (PubChem CID 11628729) has the molecular formula C30H41N3O11 and a molecular weight of 619.67 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-acetamido-3,4-diacetyloxy-6-[[4-[6-(prop-2-enoylamino)hexanoylamino]phenyl]methoxy]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5R)-5-acetamido-3,4-diacetyloxy-6-[[4-[6-(prop-2-enoylamino)hexanoylamino]phenyl]methoxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 11628729 |
| Molecular Formula | C30H41N3O11 |
| Molecular Weight | 619.67 g/mol |
| Exact Mass | 619.27 |
| IUPAC Name | [(2R,3S,4R,5R)-5-acetamido-3,4-diacetyloxy-6-[[4-[6-(prop-2-enoylamino)hexanoylamino]phenyl]methoxy]oxan-2-yl]methyl acetate |
| SMILES | C=CC(=O)NCCCCCC(=O)Nc1ccc(COC2O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]2NC(C)=O)cc1 |
| InChI | InChI=1S/C30H41N3O11/c1-6-25(38)31-15-9-7-8-10-26(39)33-23-13-11-22(12-14-23)16-41-30-27(32-18(2)34)29(43-21(5)37)28(42-20(4)36)24(44-30)17-40-19(3)35/h6,11-14,24,27-30H,1,7-10,15-17H2,2-5H3,(H,31,38)(H,32,34)(H,33,39)/t24-,27-,28-,29-,30?/m1/s1 |
| InChIKey | KLGAMNUISUGTQS-RDLZWMEQSA-N |
| XLogP | 1.66 |
| TPSA | 184.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.67 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|