C30H41N3O11 — CID 68718434
[(2R,3S,4R)-3,4-diacetyloxy-6-[2-oxo-2-[[4-[6-(prop-2-enoylamino)hexanoylamino]phenyl]methylamino]ethoxy]oxan-2-yl]methyl acetate (PubChem CID 68718434) has the molecular formula C30H41N3O11 and a molecular weight of 619.67 g/mol. Its IUPAC name is [(2R,3S,4R)-3,4-diacetyloxy-6-[2-oxo-2-[[4-[6-(prop-2-enoylamino)hexanoylamino]phenyl]methylamino]ethoxy]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R)-3,4-diacetyloxy-6-[2-oxo-2-[[4-[6-(prop-2-enoylamino)hexanoylamino]phenyl]methylamino]ethoxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 68718434 |
| Molecular Formula | C30H41N3O11 |
| Molecular Weight | 619.67 g/mol |
| Exact Mass | 619.27 |
| IUPAC Name | [(2R,3S,4R)-3,4-diacetyloxy-6-[2-oxo-2-[[4-[6-(prop-2-enoylamino)hexanoylamino]phenyl]methylamino]ethoxy]oxan-2-yl]methyl acetate |
| SMILES | C=CC(=O)NCCCCCC(=O)Nc1ccc(CNC(=O)COC2C[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](COC(C)=O)O2)cc1 |
| InChI | InChI=1S/C30H41N3O11/c1-5-26(37)31-14-8-6-7-9-27(38)33-23-12-10-22(11-13-23)16-32-28(39)18-41-29-15-24(42-20(3)35)30(43-21(4)36)25(44-29)17-40-19(2)34/h5,10-13,24-25,29-30H,1,6-9,14-18H2,2-4H3,(H,31,37)(H,32,39)(H,33,38)/t24-,25-,29?,30+/m1/s1 |
| InChIKey | NJLLTYKKVWQTPL-FXCTWSPVSA-N |
| XLogP | 1.66 |
| TPSA | 184.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.67 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|