C21H28O10 — CID 10939099
[(2R,3S,4R,6R)-3,4-diacetyloxy-6-[(3,4-dimethoxyphenyl)methoxy]oxan-2-yl]methyl acetate (PubChem CID 10939099) has the molecular formula C21H28O10 and a molecular weight of 440.45 g/mol. Its IUPAC name is [(2R,3S,4R,6R)-3,4-diacetyloxy-6-[(3,4-dimethoxyphenyl)methoxy]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,6R)-3,4-diacetyloxy-6-[(3,4-dimethoxyphenyl)methoxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 10939099 |
| Molecular Formula | C21H28O10 |
| Molecular Weight | 440.45 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | [(2R,3S,4R,6R)-3,4-diacetyloxy-6-[(3,4-dimethoxyphenyl)methoxy]oxan-2-yl]methyl acetate |
| SMILES | COc1ccc(CO[C@H]2C[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](COC(C)=O)O2)cc1OC |
| InChI | InChI=1S/C21H28O10/c1-12(22)27-11-19-21(30-14(3)24)18(29-13(2)23)9-20(31-19)28-10-15-6-7-16(25-4)17(8-15)26-5/h6-8,18-21H,9-11H2,1-5H3/t18-,19-,20-,21+/m1/s1 |
| InChIKey | JAFKUUZEQJJFAR-NCYKPQTJSA-N |
| XLogP | 1.76 |
| TPSA | 115.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.45 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|