C19H30O10 — CID 15699251
methyl 6-[(2S,4R,5S,6R)-4,5-diacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyhexanoate (PubChem CID 15699251) has the molecular formula C19H30O10 and a molecular weight of 418.44 g/mol. Its IUPAC name is methyl 6-[(2S,4R,5S,6R)-4,5-diacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyhexanoate.
| Compound Name | methyl 6-[(2S,4R,5S,6R)-4,5-diacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyhexanoate |
|---|---|
| PubChem CID | 15699251 |
| Molecular Formula | C19H30O10 |
| Molecular Weight | 418.44 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | methyl 6-[(2S,4R,5S,6R)-4,5-diacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyhexanoate |
| SMILES | COC(=O)CCCCCO[C@@H]1C[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](COC(C)=O)O1 |
| InChI | InChI=1S/C19H30O10/c1-12(20)26-11-16-19(28-14(3)22)15(27-13(2)21)10-18(29-16)25-9-7-5-6-8-17(23)24-4/h15-16,18-19H,5-11H2,1-4H3/t15-,16-,18+,19+/m1/s1 |
| InChIKey | DLILCHDQKMIZFX-FPAYPSAMSA-N |
| XLogP | 1.28 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.44 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|