C17H27NO9 — CID 155479284
[(3R,6R)-6-(3-acetamidopropoxy)-3,4-diacetyloxyoxan-2-yl]methyl acetate (PubChem CID 155479284) has the molecular formula C17H27NO9 and a molecular weight of 389.40 g/mol. Its IUPAC name is [(3R,6R)-6-(3-acetamidopropoxy)-3,4-diacetyloxyoxan-2-yl]methyl acetate.
| Compound Name | [(3R,6R)-6-(3-acetamidopropoxy)-3,4-diacetyloxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 155479284 |
| Molecular Formula | C17H27NO9 |
| Molecular Weight | 389.40 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | [(3R,6R)-6-(3-acetamidopropoxy)-3,4-diacetyloxyoxan-2-yl]methyl acetate |
| SMILES | CC(=O)NCCCO[C@H]1CC(OC(C)=O)[C@@H](OC(C)=O)C(COC(C)=O)O1 |
| InChI | InChI=1S/C17H27NO9/c1-10(19)18-6-5-7-23-16-8-14(25-12(3)21)17(26-13(4)22)15(27-16)9-24-11(2)20/h14-17H,5-9H2,1-4H3,(H,18,19)/t14?,15?,16-,17-/m1/s1 |
| InChIKey | KFRRHIKWJNXOMI-BHUNQDJPSA-N |
| XLogP | 0.07 |
| TPSA | 126.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.40 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|