C18H28O8 — CID 11222514
[(2R,3S,4R,6S)-3,4-diacetyloxy-6-[(Z)-hex-3-enoxy]oxan-2-yl]methyl acetate (PubChem CID 11222514) has the molecular formula C18H28O8 and a molecular weight of 372.41 g/mol. Its IUPAC name is [(2R,3S,4R,6S)-3,4-diacetyloxy-6-[(Z)-hex-3-enoxy]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,6S)-3,4-diacetyloxy-6-[(Z)-hex-3-enoxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 11222514 |
| Molecular Formula | C18H28O8 |
| Molecular Weight | 372.41 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | [(2R,3S,4R,6S)-3,4-diacetyloxy-6-[(Z)-hex-3-enoxy]oxan-2-yl]methyl acetate |
| SMILES | CC/C=C\CCO[C@@H]1C[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](COC(C)=O)O1 |
| InChI | InChI=1S/C18H28O8/c1-5-6-7-8-9-22-17-10-15(24-13(3)20)18(25-14(4)21)16(26-17)11-23-12(2)19/h6-7,15-18H,5,8-11H2,1-4H3/b7-6-/t15-,16-,17+,18+/m1/s1 |
| InChIKey | JFWBEUWBWBLRPO-VDDZRTKESA-N |
| XLogP | 1.90 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.41 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|