C24H41NO12 — CID 126647911
[(2R,3R,4R,6R)-3,4-diacetyloxy-6-[2-[2-[2-[2-(butylamino)-2-oxoethoxy]ethoxy]ethoxy]ethoxy]oxan-2-yl]methyl acetate (PubChem CID 126647911) has the molecular formula C24H41NO12 and a molecular weight of 535.59 g/mol. Its IUPAC name is [(2R,3R,4R,6R)-3,4-diacetyloxy-6-[2-[2-[2-[2-(butylamino)-2-oxoethoxy]ethoxy]ethoxy]ethoxy]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,6R)-3,4-diacetyloxy-6-[2-[2-[2-[2-(butylamino)-2-oxoethoxy]ethoxy]ethoxy]ethoxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 126647911 |
| Molecular Formula | C24H41NO12 |
| Molecular Weight | 535.59 g/mol |
| Exact Mass | 535.26 |
| IUPAC Name | [(2R,3R,4R,6R)-3,4-diacetyloxy-6-[2-[2-[2-[2-(butylamino)-2-oxoethoxy]ethoxy]ethoxy]ethoxy]oxan-2-yl]methyl acetate |
| SMILES | CCCCNC(=O)COCCOCCOCCO[C@H]1C[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H](COC(C)=O)O1 |
| InChI | InChI=1S/C24H41NO12/c1-5-6-7-25-22(29)16-32-11-10-30-8-9-31-12-13-33-23-14-20(35-18(3)27)24(36-19(4)28)21(37-23)15-34-17(2)26/h20-21,23-24H,5-16H2,1-4H3,(H,25,29)/t20-,21-,23-,24-/m1/s1 |
| InChIKey | DSGMRFLVOZLUPB-LUGTWXOSSA-N |
| XLogP | 0.51 |
| TPSA | 154.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.59 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|