C18H35NO9 — CID 166695265
N-butyl-2-[2-[2-[2-[(4R,5R,6R)-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethoxy]ethoxy]ethoxy]acetamide (PubChem CID 166695265) has the molecular formula C18H35NO9 and a molecular weight of 409.48 g/mol. Its IUPAC name is N-butyl-2-[2-[2-[2-[(4R,5R,6R)-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethoxy]ethoxy]ethoxy]acetamide.
| Compound Name | N-butyl-2-[2-[2-[2-[(4R,5R,6R)-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethoxy]ethoxy]ethoxy]acetamide |
|---|---|
| PubChem CID | 166695265 |
| Molecular Formula | C18H35NO9 |
| Molecular Weight | 409.48 g/mol |
| Exact Mass | 409.23 |
| IUPAC Name | N-butyl-2-[2-[2-[2-[(4R,5R,6R)-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethoxy]ethoxy]ethoxy]acetamide |
| SMILES | CCCCNC(=O)COCCOCCOCCOC1C[C@@H](O)[C@@H](O)[C@@H](CO)O1 |
| InChI | InChI=1S/C18H35NO9/c1-2-3-4-19-16(22)13-26-8-7-24-5-6-25-9-10-27-17-11-14(21)18(23)15(12-20)28-17/h14-15,17-18,20-21,23H,2-13H2,1H3,(H,19,22)/t14-,15-,17?,18-/m1/s1 |
| InChIKey | GCYAVEKMDZBARX-IXOSTLECSA-N |
| XLogP | -1.20 |
| TPSA | 135.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.48 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|