C11H21NO7 — CID 177155402
N-[2-[2-[4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethoxy]ethyl]formamide (PubChem CID 177155402) has the molecular formula C11H21NO7 and a molecular weight of 279.29 g/mol. Its IUPAC name is N-[2-[2-[4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethoxy]ethyl]formamide.
| Compound Name | N-[2-[2-[4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethoxy]ethyl]formamide |
|---|---|
| PubChem CID | 177155402 |
| Molecular Formula | C11H21NO7 |
| Molecular Weight | 279.29 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | N-[2-[2-[4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethoxy]ethyl]formamide |
| SMILES | O=CNCCOCCOC1CC(O)C(O)C(CO)O1 |
| InChI | InChI=1S/C11H21NO7/c13-6-9-11(16)8(15)5-10(19-9)18-4-3-17-2-1-12-7-14/h7-11,13,15-16H,1-6H2,(H,12,14) |
| InChIKey | QTYFYACMENGTPR-UHFFFAOYSA-N |
| XLogP | -2.41 |
| TPSA | 117.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.29 |
| LogP ≤ 5 | -2.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|