C49H90BN5O24 — CID 177155400
CID 177155400 (PubChem CID 177155400) has the molecular formula C49H90BN5O24 and a molecular weight of 1144.08 g/mol.
| Compound Name | CID 177155400 |
|---|---|
| PubChem CID | 177155400 |
| Molecular Formula | C49H90BN5O24 |
| Molecular Weight | 1144.08 g/mol |
| Exact Mass | 1143.61 |
| IUPAC Name | — |
| SMILES | CCCC(NC(=O)CCC(NC)C(=O)NCCOCCOC1CC(O)C(O)C(CO)O1)C(=O)NCCOCCOC1CC(O)C(O)C(CO)O1.O=CNCCOCCOC1CC(O)C(O)C(CO)O1.[B]OC1CCC(C=O)CC1 |
| InChI | InChI=1S/C31H58N4O15.C11H21NO7.C7H11BO2/c1-3-4-20(31(44)34-8-10-46-12-14-48-27-16-22(39)29(42)24(18-37)50-27)35-25(40)6-5-19(32-2)30(43)33-7-9-45-11-13-47-26-15-21(38)28(41)23(17-36)49-26;13-6-9-11(16)8(15)5-10(19-9)18-4-3-17-2-1-12-7-14;8-10-7-3-1-6(5-9)2-4-7/h19-24,26-29,32,36-39,41-42H,3-18H2,1-2H3,(H,33,43)(H,34,44)(H,35,40);7-11,13,15-16H,1-6H2,(H,12,14);5-7H,1-4H2 |
| InChIKey | VZFWPKOMORPFFK-UHFFFAOYSA-N |
| XLogP | -5.96 |
| TPSA | 419.87 Ų |
| H-Bond Donors | 14 |
| H-Bond Acceptors | 25 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 79 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1144.08 |
| LogP ≤ 5 | -5.96 |
| H-Bond Donors ≤ 5 | 14 |
| H-Bond Acceptors ≤ 10 | 25 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|