C21H33N3O8 — CID 163289913
4-[(Z)-1-amino-2-[amino-[2-[2-[2-[4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethoxy]ethoxy]ethyl]amino]ethenyl]benzaldehyde (PubChem CID 163289913) has the molecular formula C21H33N3O8 and a molecular weight of 455.51 g/mol. Its IUPAC name is 4-[(Z)-1-amino-2-[amino-[2-[2-[2-[4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethoxy]ethoxy]ethyl]amino]ethenyl]benzaldehyde.
| Compound Name | 4-[(Z)-1-amino-2-[amino-[2-[2-[2-[4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethoxy]ethoxy]ethyl]amino]ethenyl]benzaldehyde |
|---|---|
| PubChem CID | 163289913 |
| Molecular Formula | C21H33N3O8 |
| Molecular Weight | 455.51 g/mol |
| Exact Mass | 455.23 |
| IUPAC Name | 4-[(Z)-1-amino-2-[amino-[2-[2-[2-[4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethoxy]ethoxy]ethyl]amino]ethenyl]benzaldehyde |
| SMILES | N/C(=C\N(N)CCOCCOCCOC1CC(O)C(O)C(CO)O1)c1ccc(C=O)cc1 |
| InChI | InChI=1S/C21H33N3O8/c22-17(16-3-1-15(13-25)2-4-16)12-24(23)5-6-29-7-8-30-9-10-31-20-11-18(27)21(28)19(14-26)32-20/h1-4,12-13,18-21,26-28H,5-11,14,22-23H2/b17-12- |
| InChIKey | OIDMRFYHLPRJCN-ATVHPVEESA-N |
| XLogP | -1.19 |
| TPSA | 169.96 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.51 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|