C20H34O8 — CID 100922214
[(2R,3R,4R,6S)-3,4-diacetyloxy-6-octoxyoxan-2-yl]methyl acetate (PubChem CID 100922214) has the molecular formula C20H34O8 and a molecular weight of 402.48 g/mol. Its IUPAC name is [(2R,3R,4R,6S)-3,4-diacetyloxy-6-octoxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,6S)-3,4-diacetyloxy-6-octoxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 100922214 |
| Molecular Formula | C20H34O8 |
| Molecular Weight | 402.48 g/mol |
| Exact Mass | 402.23 |
| IUPAC Name | [(2R,3R,4R,6S)-3,4-diacetyloxy-6-octoxyoxan-2-yl]methyl acetate |
| SMILES | CCCCCCCCO[C@@H]1C[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H](COC(C)=O)O1 |
| InChI | InChI=1S/C20H34O8/c1-5-6-7-8-9-10-11-24-19-12-17(26-15(3)22)20(27-16(4)23)18(28-19)13-25-14(2)21/h17-20H,5-13H2,1-4H3/t17-,18-,19+,20-/m1/s1 |
| InChIKey | ZFKHLILOFINGAV-YSTOQKLRSA-N |
| XLogP | 2.90 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.48 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|