C20H30O11 — CID 126615461
2-[2-[(2R,4R,5R,6R)-4,5-diacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyethoxy]ethyl 2-methylprop-2-enoate (PubChem CID 126615461) has the molecular formula C20H30O11 and a molecular weight of 446.45 g/mol. Its IUPAC name is 2-[2-[(2R,4R,5R,6R)-4,5-diacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyethoxy]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[2-[(2R,4R,5R,6R)-4,5-diacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyethoxy]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 126615461 |
| Molecular Formula | C20H30O11 |
| Molecular Weight | 446.45 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | 2-[2-[(2R,4R,5R,6R)-4,5-diacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyethoxy]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOCCO[C@H]1C[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H](COC(C)=O)O1 |
| InChI | InChI=1S/C20H30O11/c1-12(2)20(24)27-9-7-25-6-8-26-18-10-16(29-14(4)22)19(30-15(5)23)17(31-18)11-28-13(3)21/h16-19H,1,6-11H2,2-5H3/t16-,17-,18-,19-/m1/s1 |
| InChIKey | WNVSRLVMLLRHRM-NCXUSEDFSA-N |
| XLogP | 0.68 |
| TPSA | 132.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.45 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|