C28H29NO11S — CID 91040431
methyl 4-[4-[[(2R,4R,5S,6R)-4,5-diacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxymethyl]phenoxy]thieno[2,3-c]pyridine-2-carboxylate (PubChem CID 91040431) has the molecular formula C28H29NO11S and a molecular weight of 587.60 g/mol. Its IUPAC name is methyl 4-[4-[[(2R,4R,5S,6R)-4,5-diacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxymethyl]phenoxy]thieno[2,3-c]pyridine-2-carboxylate.
| Compound Name | methyl 4-[4-[[(2R,4R,5S,6R)-4,5-diacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxymethyl]phenoxy]thieno[2,3-c]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 91040431 |
| Molecular Formula | C28H29NO11S |
| Molecular Weight | 587.60 g/mol |
| Exact Mass | 587.15 |
| IUPAC Name | methyl 4-[4-[[(2R,4R,5S,6R)-4,5-diacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxymethyl]phenoxy]thieno[2,3-c]pyridine-2-carboxylate |
| SMILES | COC(=O)c1cc2c(Oc3ccc(CO[C@H]4C[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](COC(C)=O)O4)cc3)cncc2s1 |
| InChI | InChI=1S/C28H29NO11S/c1-15(30)35-14-23-27(38-17(3)32)21(37-16(2)31)10-26(40-23)36-13-18-5-7-19(8-6-18)39-22-11-29-12-25-20(22)9-24(41-25)28(33)34-4/h5-9,11-12,21,23,26-27H,10,13-14H2,1-4H3/t21-,23-,26-,27+/m1/s1 |
| InChIKey | DPUMRVAPMGKYEH-RXDRQECZSA-N |
| XLogP | 3.93 |
| TPSA | 145.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.60 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|