C17H20O9S — CID 141081236
[3,4-diacetyloxy-6-(2-formylthiophen-3-yl)oxyoxan-2-yl]methyl acetate (PubChem CID 141081236) has the molecular formula C17H20O9S and a molecular weight of 400.41 g/mol. Its IUPAC name is [3,4-diacetyloxy-6-(2-formylthiophen-3-yl)oxyoxan-2-yl]methyl acetate.
| Compound Name | [3,4-diacetyloxy-6-(2-formylthiophen-3-yl)oxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 141081236 |
| Molecular Formula | C17H20O9S |
| Molecular Weight | 400.41 g/mol |
| Exact Mass | 400.08 |
| IUPAC Name | [3,4-diacetyloxy-6-(2-formylthiophen-3-yl)oxyoxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1OC(Oc2ccsc2C=O)CC(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C17H20O9S/c1-9(19)22-8-14-17(24-11(3)21)13(23-10(2)20)6-16(26-14)25-12-4-5-27-15(12)7-18/h4-5,7,13-14,16-17H,6,8H2,1-3H3 |
| InChIKey | PTDDIMFUFPYJCT-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.41 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|